C10H13Cl — CID 561709
10-chlorotricyclo[4.3.1.03,8]dec-4-ene (PubChem CID 561709) has the molecular formula C10H13Cl and a molecular weight of 168.67 g/mol. Its IUPAC name is 10-chlorotricyclo[4.3.1.03,8]dec-4-ene.
| Compound Name | 10-chlorotricyclo[4.3.1.03,8]dec-4-ene |
|---|---|
| PubChem CID | 561709 |
| Molecular Formula | C10H13Cl |
| Molecular Weight | 168.67 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 10-chlorotricyclo[4.3.1.03,8]dec-4-ene |
| SMILES | ClC1C2C=CC3CC1CC3C2 |
| InChI | InChI=1S/C10H13Cl/c11-10-7-2-1-6-3-9(10)5-8(6)4-7/h1-2,6-10H,3-5H2 |
| InChIKey | PTJBCHBGTJGYLO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.67 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|