C12H15Cl — CID 98505466
(1S,2S,3R,6R,7S,8S,9S)-9-chlorotetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 98505466) has the molecular formula C12H15Cl and a molecular weight of 194.70 g/mol. Its IUPAC name is (1S,2S,3R,6R,7S,8S,9S)-9-chlorotetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | (1S,2S,3R,6R,7S,8S,9S)-9-chlorotetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 98505466 |
| Molecular Formula | C12H15Cl |
| Molecular Weight | 194.70 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (1S,2S,3R,6R,7S,8S,9S)-9-chlorotetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | Cl[C@H]1C[C@@H]2C[C@H]1[C@@H]1[C@@H]2[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H15Cl/c13-10-5-8-4-9(10)12-7-2-1-6(3-7)11(8)12/h1-2,6-12H,3-5H2/t6-,7-,8-,9+,10-,11+,12+/m0/s1 |
| InChIKey | JAUWSFRBDNDALH-AMDVPWGISA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.70 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|