C16H22 — CID 123420244
9-but-1-en-2-yltetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 123420244) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 9-but-1-en-2-yltetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | 9-but-1-en-2-yltetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 123420244 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 9-but-1-en-2-yltetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | C=C(CC)C1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C16H22/c1-3-9(2)13-7-12-8-14(13)16-11-5-4-10(6-11)15(12)16/h4-5,10-16H,2-3,6-8H2,1H3 |
| InChIKey | IWMAVKFCLAXFIY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|