C20H26 — CID 139655368
11-prop-1-en-2-ylhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-4-ene (PubChem CID 139655368) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is 11-prop-1-en-2-ylhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-4-ene.
| Compound Name | 11-prop-1-en-2-ylhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-4-ene |
|---|---|
| PubChem CID | 139655368 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 11-prop-1-en-2-ylhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-4-ene |
| SMILES | C=C(C)C1CC2CC1C1C3CC(C4C5C=CC(C5)C34)C21 |
| InChI | InChI=1S/C20H26/c1-9(2)13-6-12-7-14(13)20-16-8-15(19(12)20)17-10-3-4-11(5-10)18(16)17/h3-4,10-20H,1,5-8H2,2H3 |
| InChIKey | HKXIWGUYIBVGPF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|