C17H25NO3 — CID 139919678
N,N-diethoxytetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxamide (PubChem CID 139919678) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is N,N-diethoxytetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxamide.
| Compound Name | N,N-diethoxytetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxamide |
|---|---|
| PubChem CID | 139919678 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N,N-diethoxytetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxamide |
| SMILES | CCON(OCC)C(=O)C1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C17H25NO3/c1-3-20-18(21-4-2)17(19)14-9-12-8-13(14)16-11-6-5-10(7-11)15(12)16/h5-6,10-16H,3-4,7-9H2,1-2H3 |
| InChIKey | ZZONTNITYFZYBH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|