C12H19NO3 — CID 87822883
N,N-diethoxybicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 87822883) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is N,N-diethoxybicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | N,N-diethoxybicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 87822883 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | N,N-diethoxybicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CCON(OCC)C(=O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C12H19NO3/c1-3-15-13(16-4-2)12(14)11-8-9-5-6-10(11)7-9/h5-6,9-11H,3-4,7-8H2,1-2H3 |
| InChIKey | VXDVZDCBUZQWRS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|