C13H17NO3 — CID 54946073
2-[bicyclo[2.2.1]hept-5-ene-2-carbonyl(cyclopropyl)amino]acetic acid (PubChem CID 54946073) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-[bicyclo[2.2.1]hept-5-ene-2-carbonyl(cyclopropyl)amino]acetic acid.
| Compound Name | 2-[bicyclo[2.2.1]hept-5-ene-2-carbonyl(cyclopropyl)amino]acetic acid |
|---|---|
| PubChem CID | 54946073 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-[bicyclo[2.2.1]hept-5-ene-2-carbonyl(cyclopropyl)amino]acetic acid |
| SMILES | O=C(O)CN(C(=O)C1CC2C=CC1C2)C1CC1 |
| InChI | InChI=1S/C13H17NO3/c15-12(16)7-14(10-3-4-10)13(17)11-6-8-1-2-9(11)5-8/h1-2,8-11H,3-7H2,(H,15,16) |
| InChIKey | JEBVHYKXPYVADH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|