2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid

C9H14N2O3S — CID 61161099

IUPAC2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid
SMILESO=C(O)CN(C(=O)C1CSCN1)C1CC1
InChIInChI=1S/C9H14N2O3S/c12-8(13)3-11(6-1-2-6)9(14)7-4-15-5-10-7/h6-7,10H,1-5H2,(H,12,13)
InChIKeyYAQHPCCGTMNVRL-UHFFFAOYSA-N
MW230.29 g/mol
LogP-0.28
Rot. Bonds4

About 2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid

2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid (PubChem CID 61161099) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid.

Molecular Properties

Compound Name2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid
PubChem CID61161099
Molecular FormulaC9H14N2O3S
Molecular Weight230.29 g/mol
Exact Mass230.07
IUPAC Name2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid
SMILESO=C(O)CN(C(=O)C1CSCN1)C1CC1
InChIInChI=1S/C9H14N2O3S/c12-8(13)3-11(6-1-2-6)9(14)7-4-15-5-10-7/h6-7,10H,1-5H2,(H,12,13)
InChIKeyYAQHPCCGTMNVRL-UHFFFAOYSA-N
XLogP-0.28
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.29
LogP ≤ 5-0.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid?
The IUPAC name of 2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid (CID 61161099) is 2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid is O=C(O)CN(C(=O)C1CSCN1)C1CC1.
What is the InChIKey of 2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid?
The InChIKey is YAQHPCCGTMNVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3S/c12-8(13)3-11(6-1-2-6)9(14)7-4-15-5-10-7/h6-7,10H,1-5H2,(H,12,13).
What are the key properties of 2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid?
2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid has a molecular weight of 230.29 g/mol, XLogP of -0.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopropyl(1,3-thiazolidine-4-carbonyl)amino]acetic acid is sourced from PubChem (CID 61161099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).