C11H16N2O4S — CID 60826938
2-[cyclopentyl-(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetic acid (PubChem CID 60826938) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[cyclopentyl-(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetic acid.
| Compound Name | 2-[cyclopentyl-(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 60826938 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[cyclopentyl-(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CN(C(=O)C1CSC(=O)N1)C1CCCC1 |
| InChI | InChI=1S/C11H16N2O4S/c14-9(15)5-13(7-3-1-2-4-7)10(16)8-6-18-11(17)12-8/h7-8H,1-6H2,(H,12,17)(H,14,15) |
| InChIKey | ANHXJSUPBYMBQV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|