C7H10N2O4S — CID 43211125
2-[methyl-(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetic acid (PubChem CID 43211125) has the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. Its IUPAC name is 2-[methyl-(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetic acid.
| Compound Name | 2-[methyl-(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 43211125 |
| Molecular Formula | C7H10N2O4S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 2-[methyl-(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)C1CSC(=O)N1 |
| InChI | InChI=1S/C7H10N2O4S/c1-9(2-5(10)11)6(12)4-3-14-7(13)8-4/h4H,2-3H2,1H3,(H,8,13)(H,10,11) |
| InChIKey | OHWXVIUPVBOVEP-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|