C7H13N3O2S — CID 62686799
N-(2-aminoethyl)-N-methyl-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 62686799) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-methyl-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-N-methyl-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 62686799 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-(2-aminoethyl)-N-methyl-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | CN(CCN)C(=O)C1CSC(=O)N1 |
| InChI | InChI=1S/C7H13N3O2S/c1-10(3-2-8)6(11)5-4-13-7(12)9-5/h5H,2-4,8H2,1H3,(H,9,12) |
| InChIKey | DHKAYTVDILQYRW-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|