C13H21N3O2S — CID 106626889
N-cyclopropyl-2-oxo-N-(piperidin-2-ylmethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 106626889) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-cyclopropyl-2-oxo-N-(piperidin-2-ylmethyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-cyclopropyl-2-oxo-N-(piperidin-2-ylmethyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 106626889 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-cyclopropyl-2-oxo-N-(piperidin-2-ylmethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)N(CC2CCCCN2)C2CC2)CS1 |
| InChI | InChI=1S/C13H21N3O2S/c17-12(11-8-19-13(18)15-11)16(10-4-5-10)7-9-3-1-2-6-14-9/h9-11,14H,1-8H2,(H,15,18) |
| InChIKey | UDGUHKSYPUIVPZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|