C10H16N2O4S — CID 60828880
2-[butan-2-yl-(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetic acid (PubChem CID 60828880) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 2-[butan-2-yl-(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetic acid.
| Compound Name | 2-[butan-2-yl-(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 60828880 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-[butan-2-yl-(2-oxo-1,3-thiazolidine-4-carbonyl)amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)C1CSC(=O)N1 |
| InChI | InChI=1S/C10H16N2O4S/c1-3-6(2)12(4-8(13)14)9(15)7-5-17-10(16)11-7/h6-7H,3-5H2,1-2H3,(H,11,16)(H,13,14) |
| InChIKey | CEXLILWFENTRJT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|