C14H19NO5S — CID 60846071
2-[bicyclo[2.2.1]hept-5-ene-2-carbonyl-(1,1-dioxothiolan-3-yl)amino]acetic acid (PubChem CID 60846071) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-[bicyclo[2.2.1]hept-5-ene-2-carbonyl-(1,1-dioxothiolan-3-yl)amino]acetic acid.
| Compound Name | 2-[bicyclo[2.2.1]hept-5-ene-2-carbonyl-(1,1-dioxothiolan-3-yl)amino]acetic acid |
|---|---|
| PubChem CID | 60846071 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[bicyclo[2.2.1]hept-5-ene-2-carbonyl-(1,1-dioxothiolan-3-yl)amino]acetic acid |
| SMILES | O=C(O)CN(C(=O)C1CC2C=CC1C2)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19NO5S/c16-13(17)7-15(11-3-4-21(19,20)8-11)14(18)12-6-9-1-2-10(12)5-9/h1-2,9-12H,3-8H2,(H,16,17) |
| InChIKey | ZZUORXCKZFVBHG-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|