C21H26N2O2 — CID 98136344
(1R,2S,4S)-N-(1-benzoylpiperidin-4-yl)-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98136344) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (1R,2S,4S)-N-(1-benzoylpiperidin-4-yl)-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2S,4S)-N-(1-benzoylpiperidin-4-yl)-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98136344 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (1R,2S,4S)-N-(1-benzoylpiperidin-4-yl)-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CN(C(=O)[C@H]1C[C@H]2C=C[C@H]1C2)C1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N2O2/c1-22(21(25)19-14-15-7-8-17(19)13-15)18-9-11-23(12-10-18)20(24)16-5-3-2-4-6-16/h2-8,15,17-19H,9-14H2,1H3/t15-,17-,19-/m0/s1 |
| InChIKey | SQMPSMIQUYOYPH-IEZWGBDMSA-N |
| XLogP | 2.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|