C15H16O3S — CID 98404907
(1R,2R,4S,5R,8R,9S,11S,12R)-3,3-dioxo-3λ6-thiapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-6,13-dien-10-one (PubChem CID 98404907) has the molecular formula C15H16O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is (1R,2R,4S,5R,8R,9S,11S,12R)-3,3-dioxo-3λ6-thiapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-6,13-dien-10-one.
| Compound Name | (1R,2R,4S,5R,8R,9S,11S,12R)-3,3-dioxo-3λ6-thiapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-6,13-dien-10-one |
|---|---|
| PubChem CID | 98404907 |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (1R,2R,4S,5R,8R,9S,11S,12R)-3,3-dioxo-3λ6-thiapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-6,13-dien-10-one |
| SMILES | O=C1[C@H]2[C@H]([C@H]3C=C[C@H]2C3)S(=O)(=O)[C@H]2[C@H]1[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C15H16O3S/c16-13-11-7-1-3-9(5-7)14(11)19(17,18)15-10-4-2-8(6-10)12(13)15/h1-4,7-12,14-15H,5-6H2/t7-,8-,9-,10-,11-,12-,14-,15+/m0/s1 |
| InChIKey | GQQKMTDKKNGWRQ-DXMRSBHCSA-N |
| XLogP | 1.37 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|