C15H24O5 — CID 177468307
(1R,6E,10S,11R,15R)-2-methoxy-13,13-dimethyl-9,12,14,16-tetraoxatricyclo[8.6.0.011,15]hexadec-6-ene (PubChem CID 177468307) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (1R,6E,10S,11R,15R)-2-methoxy-13,13-dimethyl-9,12,14,16-tetraoxatricyclo[8.6.0.011,15]hexadec-6-ene.
| Compound Name | (1R,6E,10S,11R,15R)-2-methoxy-13,13-dimethyl-9,12,14,16-tetraoxatricyclo[8.6.0.011,15]hexadec-6-ene |
|---|---|
| PubChem CID | 177468307 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (1R,6E,10S,11R,15R)-2-methoxy-13,13-dimethyl-9,12,14,16-tetraoxatricyclo[8.6.0.011,15]hexadec-6-ene |
| SMILES | COC1CCC/C=C/CO[C@@H]2[C@H]3OC(C)(C)O[C@H]3O[C@H]12 |
| InChI | InChI=1S/C15H24O5/c1-15(2)19-13-12-11(18-14(13)20-15)10(16-3)8-6-4-5-7-9-17-12/h5,7,10-14H,4,6,8-9H2,1-3H3/b7-5+/t10?,11-,12+,13-,14-/m1/s1 |
| InChIKey | GAJYMPPBWDMENE-HYLGHVSNSA-N |
| XLogP | 2.00 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|