C11H14O3 — CID 101083477
(1S,2S,6R,7R)-4,4-dimethyl-3,5-dioxatricyclo[5.3.1.02,6]undec-9-en-8-one (PubChem CID 101083477) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (1S,2S,6R,7R)-4,4-dimethyl-3,5-dioxatricyclo[5.3.1.02,6]undec-9-en-8-one.
| Compound Name | (1S,2S,6R,7R)-4,4-dimethyl-3,5-dioxatricyclo[5.3.1.02,6]undec-9-en-8-one |
|---|---|
| PubChem CID | 101083477 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (1S,2S,6R,7R)-4,4-dimethyl-3,5-dioxatricyclo[5.3.1.02,6]undec-9-en-8-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1C[C@H]2C=CC1=O |
| InChI | InChI=1S/C11H14O3/c1-11(2)13-9-6-3-4-8(12)7(5-6)10(9)14-11/h3-4,6-7,9-10H,5H2,1-2H3/t6-,7+,9+,10-/m1/s1 |
| InChIKey | VMQBSDCQBZSYQI-GOZTYBTRSA-N |
| XLogP | 1.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |