C9H10O — CID 584149
5-methylidene-3a,4,6,6a-tetrahydropentalen-1-one (PubChem CID 584149) has the molecular formula C9H10O and a molecular weight of 134.18 g/mol. Its IUPAC name is 5-methylidene-3a,4,6,6a-tetrahydropentalen-1-one.
| Compound Name | 5-methylidene-3a,4,6,6a-tetrahydropentalen-1-one |
|---|---|
| PubChem CID | 584149 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 5-methylidene-3a,4,6,6a-tetrahydropentalen-1-one |
| SMILES | C=C1CC2C=CC(=O)C2C1 |
| InChI | InChI=1S/C9H10O/c1-6-4-7-2-3-9(10)8(7)5-6/h2-3,7-8H,1,4-5H2 |
| InChIKey | DNJKRDCEIXKZQT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|