C10H10O2 — CID 130863271
(1R,2S,5R,7S)-tricyclo[5.3.0.02,5]dec-8-ene-3,10-dione (PubChem CID 130863271) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (1R,2S,5R,7S)-tricyclo[5.3.0.02,5]dec-8-ene-3,10-dione.
| Compound Name | (1R,2S,5R,7S)-tricyclo[5.3.0.02,5]dec-8-ene-3,10-dione |
|---|---|
| PubChem CID | 130863271 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (1R,2S,5R,7S)-tricyclo[5.3.0.02,5]dec-8-ene-3,10-dione |
| SMILES | O=C1C[C@H]2C[C@H]3C=CC(=O)[C@H]3[C@@H]12 |
| InChI | InChI=1S/C10H10O2/c11-7-2-1-5-3-6-4-8(12)10(6)9(5)7/h1-2,5-6,9-10H,3-4H2/t5-,6-,9+,10-/m1/s1 |
| InChIKey | CTPRHIILAVWXTG-FNIZFGCXSA-N |
| XLogP | 0.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |