C11H14O — CID 130891457
(1R,5R,7S)-5-methyltricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 130891457) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (1R,5R,7S)-5-methyltricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,5R,7S)-5-methyltricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 130891457 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (1R,5R,7S)-5-methyltricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CC1CC(=O)C2C1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C11H14O/c1-6-4-9(12)11-8-3-2-7(5-8)10(6)11/h2-3,6-8,10-11H,4-5H2,1H3/t6?,7-,8+,10?,11?/m1/s1 |
| InChIKey | VCBQYXGCNKTPHX-BCMKMETASA-N |
| XLogP | 2.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|