C13H14O2S2 — CID 13090019
4,5-bis(methylsulfanyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 13090019) has the molecular formula C13H14O2S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 4,5-bis(methylsulfanyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | 4,5-bis(methylsulfanyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 13090019 |
| Molecular Formula | C13H14O2S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 4,5-bis(methylsulfanyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | CSC1=C(SC)C(=O)C2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C13H14O2S2/c1-16-12-10(14)8-6-3-4-7(5-6)9(8)11(15)13(12)17-2/h3-4,6-9H,5H2,1-2H3 |
| InChIKey | ORHRQUXXVCJJGZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|