C14H16O2S3 — CID 15642721
(1S,2S,7R,8R)-2,4,5-tris(methylsulfanyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 15642721) has the molecular formula C14H16O2S3 and a molecular weight of 312.48 g/mol. Its IUPAC name is (1S,2S,7R,8R)-2,4,5-tris(methylsulfanyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1S,2S,7R,8R)-2,4,5-tris(methylsulfanyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 15642721 |
| Molecular Formula | C14H16O2S3 |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | (1S,2S,7R,8R)-2,4,5-tris(methylsulfanyl)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | CSC1=C(SC)C(=O)[C@]2(SC)[C@@H]3C=C[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C14H16O2S3/c1-17-11-10(15)9-7-4-5-8(6-7)14(9,19-3)13(16)12(11)18-2/h4-5,7-9H,6H2,1-3H3/t7-,8+,9+,14-/m0/s1 |
| InChIKey | KLAQMZICBPOCEQ-HZFYHNGZSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|