C10H9BrO — CID 10955230
(1S,2S,6R,7R)-6-bromotricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 10955230) has the molecular formula C10H9BrO and a molecular weight of 225.09 g/mol. Its IUPAC name is (1S,2S,6R,7R)-6-bromotricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2S,6R,7R)-6-bromotricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 10955230 |
| Molecular Formula | C10H9BrO |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | (1S,2S,6R,7R)-6-bromotricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C=C[C@]2(Br)[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C10H9BrO/c11-10-4-3-8(12)9(10)6-1-2-7(10)5-6/h1-4,6-7,9H,5H2/t6-,7+,9+,10-/m1/s1 |
| InChIKey | KHVXIUNXAUSFEJ-GOZTYBTRSA-N |
| XLogP | 2.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|