C14H11BrO — CID 98557730
(1R,2S,10S,11R)-2-bromotetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7,12-tetraen-9-one (PubChem CID 98557730) has the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. Its IUPAC name is (1R,2S,10S,11R)-2-bromotetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7,12-tetraen-9-one.
| Compound Name | (1R,2S,10S,11R)-2-bromotetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7,12-tetraen-9-one |
|---|---|
| PubChem CID | 98557730 |
| Molecular Formula | C14H11BrO |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | (1R,2S,10S,11R)-2-bromotetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7,12-tetraen-9-one |
| SMILES | O=C1c2ccccc2[C@@]2(Br)[C@H]1[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C14H11BrO/c15-14-9-6-5-8(7-9)12(14)13(16)10-3-1-2-4-11(10)14/h1-6,8-9,12H,7H2/t8-,9-,12-,14+/m0/s1 |
| InChIKey | WNAFIWGKXFIPGF-XYDQJSOLSA-N |
| XLogP | 3.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|