C30H18F2O2 — CID 139095972
(1R,2R,10R,11R)-1,2-bis(4-fluorophenyl)pentacyclo[9.7.0.02,10.03,8.013,18]octadeca-3,5,7,13,15,17-hexaene-9,12-dione (PubChem CID 139095972) has the molecular formula C30H18F2O2 and a molecular weight of 448.47 g/mol. Its IUPAC name is (1R,2R,10R,11R)-1,2-bis(4-fluorophenyl)pentacyclo[9.7.0.02,10.03,8.013,18]octadeca-3,5,7,13,15,17-hexaene-9,12-dione.
| Compound Name | (1R,2R,10R,11R)-1,2-bis(4-fluorophenyl)pentacyclo[9.7.0.02,10.03,8.013,18]octadeca-3,5,7,13,15,17-hexaene-9,12-dione |
|---|---|
| PubChem CID | 139095972 |
| Molecular Formula | C30H18F2O2 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (1R,2R,10R,11R)-1,2-bis(4-fluorophenyl)pentacyclo[9.7.0.02,10.03,8.013,18]octadeca-3,5,7,13,15,17-hexaene-9,12-dione |
| SMILES | O=C1c2ccccc2[C@]2(c3ccc(F)cc3)[C@H]1[C@H]1C(=O)c3ccccc3[C@]12c1ccc(F)cc1 |
| InChI | InChI=1S/C30H18F2O2/c31-19-13-9-17(10-14-19)29-23-7-3-1-5-21(23)27(33)25(29)26-28(34)22-6-2-4-8-24(22)30(26,29)18-11-15-20(32)16-12-18/h1-16,25-26H/t25-,26-,29+,30+/m0/s1 |
| InChIKey | JNOIZUYJIXIIJK-SRPPIYJJSA-N |
| XLogP | 5.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |