About (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one
(10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one (PubChem CID 135032726) has the molecular formula C21H14FNO
and a molecular weight of 315.35 g/mol. Its IUPAC name is (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one.
Molecular Properties
| Compound Name | (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one |
| PubChem CID | 135032726 |
| Molecular Formula | C21H14FNO |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one |
| SMILES | O=C1c2ccccc2[C@@]2(c3ccc(F)cc3)Cc3ccccc3N12 |
| InChI | InChI=1S/C21H14FNO/c22-16-11-9-15(10-12-16)21-13-14-5-1-4-8-19(14)23(21)20(24)17-6-2-3-7-18(17)21/h1-12H,13H2/t21-/m0/s1 |
| InChIKey | INOYNRJIKFQKDQ-NRFANRHFSA-N |
| XLogP | 4.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one?
The IUPAC name of (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one (CID 135032726) is (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one.
What is the SMILES notation for (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one?
The canonical SMILES for (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one is O=C1c2ccccc2[C@@]2(c3ccc(F)cc3)Cc3ccccc3N12.
What is the InChIKey of (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one?
The InChIKey is INOYNRJIKFQKDQ-NRFANRHFSA-N. The full InChI is InChI=1S/C21H14FNO/c22-16-11-9-15(10-12-16)21-13-14-5-1-4-8-19(14)23(21)20(24)17-6-2-3-7-18(17)21/h1-12H,13H2/t21-/m0/s1.
What are the key properties of (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one?
(10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one has a molecular weight of 315.35 g/mol, XLogP of 4.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (10bS)-10b-(4-fluorophenyl)-11H-isoindolo[2,1-a]indol-6-one is sourced from PubChem (CID 135032726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).