C23H16ClNO3 — CID 172635698
11a-(4-chlorophenyl)-9-methoxy-11H-indolo[1,2-b]isoquinoline-6,12-dione (PubChem CID 172635698) has the molecular formula C23H16ClNO3 and a molecular weight of 389.84 g/mol. Its IUPAC name is 11a-(4-chlorophenyl)-9-methoxy-11H-indolo[1,2-b]isoquinoline-6,12-dione.
| Compound Name | 11a-(4-chlorophenyl)-9-methoxy-11H-indolo[1,2-b]isoquinoline-6,12-dione |
|---|---|
| PubChem CID | 172635698 |
| Molecular Formula | C23H16ClNO3 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 11a-(4-chlorophenyl)-9-methoxy-11H-indolo[1,2-b]isoquinoline-6,12-dione |
| SMILES | COc1ccc2c(c1)CC1(c3ccc(Cl)cc3)C(=O)c3ccccc3N1C2=O |
| InChI | InChI=1S/C23H16ClNO3/c1-28-17-10-11-18-14(12-17)13-23(15-6-8-16(24)9-7-15)21(26)19-4-2-3-5-20(19)25(23)22(18)27/h2-12H,13H2,1H3 |
| InChIKey | BJVRBRNRRRGMKN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |