C23H20O4S — CID 10091915
(1S,2S,11R,12R)-5-methoxy-2-[(S)-(4-methylphenyl)sulfinyl]tetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7,13-tetraene-3,10-dione (PubChem CID 10091915) has the molecular formula C23H20O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is (1S,2S,11R,12R)-5-methoxy-2-[(S)-(4-methylphenyl)sulfinyl]tetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7,13-tetraene-3,10-dione.
| Compound Name | (1S,2S,11R,12R)-5-methoxy-2-[(S)-(4-methylphenyl)sulfinyl]tetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7,13-tetraene-3,10-dione |
|---|---|
| PubChem CID | 10091915 |
| Molecular Formula | C23H20O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (1S,2S,11R,12R)-5-methoxy-2-[(S)-(4-methylphenyl)sulfinyl]tetracyclo[10.2.1.02,11.04,9]pentadeca-4(9),5,7,13-tetraene-3,10-dione |
| SMILES | COc1cccc2c1C(=O)[C@]1([S@@](=O)c3ccc(C)cc3)[C@@H]3C=C[C@@H](C3)[C@@H]1C2=O |
| InChI | InChI=1S/C23H20O4S/c1-13-6-10-16(11-7-13)28(26)23-15-9-8-14(12-15)20(23)21(24)17-4-3-5-18(27-2)19(17)22(23)25/h3-11,14-15,20H,12H2,1-2H3/t14-,15+,20+,23-,28-/m0/s1 |
| InChIKey | IYFUXDUSTMJULB-UUIWZMKHSA-N |
| XLogP | 3.75 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|