C15H16O5 — CID 134962885
(4aS,9aR)-4a,9a-dihydroxy-5-methoxy-1,2,3,4-tetrahydroanthracene-9,10-dione (PubChem CID 134962885) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (4aS,9aR)-4a,9a-dihydroxy-5-methoxy-1,2,3,4-tetrahydroanthracene-9,10-dione.
| Compound Name | (4aS,9aR)-4a,9a-dihydroxy-5-methoxy-1,2,3,4-tetrahydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 134962885 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (4aS,9aR)-4a,9a-dihydroxy-5-methoxy-1,2,3,4-tetrahydroanthracene-9,10-dione |
| SMILES | COc1cccc2c1C(=O)[C@]1(O)CCCC[C@]1(O)C2=O |
| InChI | InChI=1S/C15H16O5/c1-20-10-6-4-5-9-11(10)13(17)15(19)8-3-2-7-14(15,18)12(9)16/h4-6,18-19H,2-3,7-8H2,1H3/t14-,15+/m0/s1 |
| InChIKey | FFDPVBIVUAIHRT-LSDHHAIUSA-N |
| XLogP | 1.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|