About 5-methoxy-2,2-dimethyl-3H-chromen-4-one
5-methoxy-2,2-dimethyl-3H-chromen-4-one (PubChem CID 11790374) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-methoxy-2,2-dimethyl-3H-chromen-4-one.
Molecular Properties
| Compound Name | 5-methoxy-2,2-dimethyl-3H-chromen-4-one |
| PubChem CID | 11790374 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 5-methoxy-2,2-dimethyl-3H-chromen-4-one |
| SMILES | COc1cccc2c1C(=O)CC(C)(C)O2 |
| InChI | InChI=1S/C12H14O3/c1-12(2)7-8(13)11-9(14-3)5-4-6-10(11)15-12/h4-6H,7H2,1-3H3 |
| InChIKey | RWFBDXQSHYXJRA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-2,2-dimethyl-3H-chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,2-dimethyl-3H-chromen-4-one?
The IUPAC name of 5-methoxy-2,2-dimethyl-3H-chromen-4-one (CID 11790374) is 5-methoxy-2,2-dimethyl-3H-chromen-4-one.
What is the SMILES notation for 5-methoxy-2,2-dimethyl-3H-chromen-4-one?
The canonical SMILES for 5-methoxy-2,2-dimethyl-3H-chromen-4-one is COc1cccc2c1C(=O)CC(C)(C)O2.
What is the InChIKey of 5-methoxy-2,2-dimethyl-3H-chromen-4-one?
The InChIKey is RWFBDXQSHYXJRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-12(2)7-8(13)11-9(14-3)5-4-6-10(11)15-12/h4-6H,7H2,1-3H3.
What are the key properties of 5-methoxy-2,2-dimethyl-3H-chromen-4-one?
5-methoxy-2,2-dimethyl-3H-chromen-4-one has a molecular weight of 206.24 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,2-dimethyl-3H-chromen-4-one is sourced from PubChem (CID 11790374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).