C22H22O3S — CID 102518616
benzyl (1R,2S,4R)-2-(4-methylphenyl)sulfinylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 102518616) has the molecular formula C22H22O3S and a molecular weight of 366.48 g/mol. Its IUPAC name is benzyl (1R,2S,4R)-2-(4-methylphenyl)sulfinylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | benzyl (1R,2S,4R)-2-(4-methylphenyl)sulfinylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 102518616 |
| Molecular Formula | C22H22O3S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | benzyl (1R,2S,4R)-2-(4-methylphenyl)sulfinylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | Cc1ccc(S(=O)[C@@]2(C(=O)OCc3ccccc3)C[C@@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C22H22O3S/c1-16-7-11-20(12-8-16)26(24)22(14-18-9-10-19(22)13-18)21(23)25-15-17-5-3-2-4-6-17/h2-12,18-19H,13-15H2,1H3/t18-,19+,22+,26?/m1/s1 |
| InChIKey | FAYDKNJEMPSUKA-GDFYNTQJSA-N |
| XLogP | 4.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|