C20H26N2O3S — CID 102388400
benzyl N-[(2S)-3-methyl-1-[(4-methylphenyl)sulfinylamino]butan-2-yl]carbamate (PubChem CID 102388400) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is benzyl N-[(2S)-3-methyl-1-[(4-methylphenyl)sulfinylamino]butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-methyl-1-[(4-methylphenyl)sulfinylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 102388400 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | benzyl N-[(2S)-3-methyl-1-[(4-methylphenyl)sulfinylamino]butan-2-yl]carbamate |
| SMILES | Cc1ccc(S(=O)NC[C@@H](NC(=O)OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C20H26N2O3S/c1-15(2)19(13-21-26(24)18-11-9-16(3)10-12-18)22-20(23)25-14-17-7-5-4-6-8-17/h4-12,15,19,21H,13-14H2,1-3H3,(H,22,23)/t19-,26?/m1/s1 |
| InChIKey | FQDVYRVXFNLQPE-ICCFGIFFSA-N |
| XLogP | 3.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |