C18H25FN2O5 — CID 170318118
5-fluoro-3-[[3-methyl-2-(phenylmethoxycarbonylamino)butyl]amino]-4-oxopentanoic acid (PubChem CID 170318118) has the molecular formula C18H25FN2O5 and a molecular weight of 368.41 g/mol. Its IUPAC name is 5-fluoro-3-[[3-methyl-2-(phenylmethoxycarbonylamino)butyl]amino]-4-oxopentanoic acid.
| Compound Name | 5-fluoro-3-[[3-methyl-2-(phenylmethoxycarbonylamino)butyl]amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 170318118 |
| Molecular Formula | C18H25FN2O5 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 5-fluoro-3-[[3-methyl-2-(phenylmethoxycarbonylamino)butyl]amino]-4-oxopentanoic acid |
| SMILES | CC(C)C(CNC(CC(=O)O)C(=O)CF)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H25FN2O5/c1-12(2)15(10-20-14(8-17(23)24)16(22)9-19)21-18(25)26-11-13-6-4-3-5-7-13/h3-7,12,14-15,20H,8-11H2,1-2H3,(H,21,25)(H,23,24) |
| InChIKey | NFBHGEYPVHFKAC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |