C26H35FN4O10 — CID 125352339
(4R)-5-[[(2R)-1-[[(2S)-1-carboxy-4-fluoro-3-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxo-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid (PubChem CID 125352339) has the molecular formula C26H35FN4O10 and a molecular weight of 582.58 g/mol. Its IUPAC name is (4R)-5-[[(2R)-1-[[(2S)-1-carboxy-4-fluoro-3-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxo-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid.
| Compound Name | (4R)-5-[[(2R)-1-[[(2S)-1-carboxy-4-fluoro-3-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxo-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 125352339 |
| Molecular Formula | C26H35FN4O10 |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | (4R)-5-[[(2R)-1-[[(2S)-1-carboxy-4-fluoro-3-oxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-oxo-4-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](C)NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)CF |
| InChI | InChI=1S/C26H35FN4O10/c1-14(2)22(25(39)30-18(11-21(35)36)19(32)12-27)31-24(38)17(9-10-20(33)34)29-23(37)15(3)28-26(40)41-13-16-7-5-4-6-8-16/h4-8,14-15,17-18,22H,9-13H2,1-3H3,(H,28,40)(H,29,37)(H,30,39)(H,31,38)(H,33,34)(H,35,36)/t15-,17+,18-,22+/m0/s1 |
| InChIKey | YWVKPAXTHYJNJO-KANGHSEISA-N |
| XLogP | 0.29 |
| TPSA | 217.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |