C19H23FN2O7 — CID 87754234
6-fluoro-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4,5-dioxohexanoic acid (PubChem CID 87754234) has the molecular formula C19H23FN2O7 and a molecular weight of 410.40 g/mol. Its IUPAC name is 6-fluoro-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4,5-dioxohexanoic acid.
| Compound Name | 6-fluoro-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4,5-dioxohexanoic acid |
|---|---|
| PubChem CID | 87754234 |
| Molecular Formula | C19H23FN2O7 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 6-fluoro-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4,5-dioxohexanoic acid |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)NC(CC(=O)O)C(=O)C(=O)CF |
| InChI | InChI=1S/C19H23FN2O7/c1-11(2)16(22-19(28)29-10-12-6-4-3-5-7-12)18(27)21-13(8-15(24)25)17(26)14(23)9-20/h3-7,11,13,16H,8-10H2,1-2H3,(H,21,27)(H,22,28)(H,24,25)/t13?,16-/m0/s1 |
| InChIKey | JGFIJJJVACMQII-VYIIXAMBSA-N |
| XLogP | 1.00 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|