C27H25FN2O7 — CID 24866377
6-fluoro-3-[[3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]-4,5-dioxohexanoic acid (PubChem CID 24866377) has the molecular formula C27H25FN2O7 and a molecular weight of 508.50 g/mol. Its IUPAC name is 6-fluoro-3-[[3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]-4,5-dioxohexanoic acid.
| Compound Name | 6-fluoro-3-[[3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]-4,5-dioxohexanoic acid |
|---|---|
| PubChem CID | 24866377 |
| Molecular Formula | C27H25FN2O7 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 6-fluoro-3-[[3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]-4,5-dioxohexanoic acid |
| SMILES | O=C(O)CC(NC(=O)C(Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)C(=O)CF |
| InChI | InChI=1S/C27H25FN2O7/c28-15-23(31)25(34)21(14-24(32)33)29-26(35)22(30-27(36)37-16-17-7-2-1-3-8-17)13-19-11-6-10-18-9-4-5-12-20(18)19/h1-12,21-22H,13-16H2,(H,29,35)(H,30,36)(H,32,33) |
| InChIKey | ZSPIIKZXISBELW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|