C19H22F2N2O7 — CID 24866709
6-fluoro-3-[[3-fluoro-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4,5-dioxohexanoic acid (PubChem CID 24866709) has the molecular formula C19H22F2N2O7 and a molecular weight of 428.39 g/mol. Its IUPAC name is 6-fluoro-3-[[3-fluoro-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4,5-dioxohexanoic acid.
| Compound Name | 6-fluoro-3-[[3-fluoro-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4,5-dioxohexanoic acid |
|---|---|
| PubChem CID | 24866709 |
| Molecular Formula | C19H22F2N2O7 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 6-fluoro-3-[[3-fluoro-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4,5-dioxohexanoic acid |
| SMILES | CC(C)(F)C(NC(=O)OCc1ccccc1)C(=O)NC(CC(=O)O)C(=O)C(=O)CF |
| InChI | InChI=1S/C19H22F2N2O7/c1-19(2,21)16(23-18(29)30-10-11-6-4-3-5-7-11)17(28)22-12(8-14(25)26)15(27)13(24)9-20/h3-7,12,16H,8-10H2,1-2H3,(H,22,28)(H,23,29)(H,25,26) |
| InChIKey | VTLVBKLDHUKTTH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|