C20H19FN2O7S — CID 24866022
6-fluoro-4,5-dioxo-3-[[2-(phenylmethoxycarbonylamino)-2-thiophen-3-ylacetyl]amino]hexanoic acid (PubChem CID 24866022) has the molecular formula C20H19FN2O7S and a molecular weight of 450.44 g/mol. Its IUPAC name is 6-fluoro-4,5-dioxo-3-[[2-(phenylmethoxycarbonylamino)-2-thiophen-3-ylacetyl]amino]hexanoic acid.
| Compound Name | 6-fluoro-4,5-dioxo-3-[[2-(phenylmethoxycarbonylamino)-2-thiophen-3-ylacetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 24866022 |
| Molecular Formula | C20H19FN2O7S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 6-fluoro-4,5-dioxo-3-[[2-(phenylmethoxycarbonylamino)-2-thiophen-3-ylacetyl]amino]hexanoic acid |
| SMILES | O=C(O)CC(NC(=O)C(NC(=O)OCc1ccccc1)c1ccsc1)C(=O)C(=O)CF |
| InChI | InChI=1S/C20H19FN2O7S/c21-9-15(24)18(27)14(8-16(25)26)22-19(28)17(13-6-7-31-11-13)23-20(29)30-10-12-4-2-1-3-5-12/h1-7,11,14,17H,8-10H2,(H,22,28)(H,23,29)(H,25,26) |
| InChIKey | ALYXDTZVNGKKLA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|