C21H23N3O5S — CID 138730203
benzyl N-[2-[(2,3-dioxoazocan-4-yl)amino]-2-oxo-1-thiophen-3-ylethyl]carbamate (PubChem CID 138730203) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is benzyl N-[2-[(2,3-dioxoazocan-4-yl)amino]-2-oxo-1-thiophen-3-ylethyl]carbamate.
| Compound Name | benzyl N-[2-[(2,3-dioxoazocan-4-yl)amino]-2-oxo-1-thiophen-3-ylethyl]carbamate |
|---|---|
| PubChem CID | 138730203 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | benzyl N-[2-[(2,3-dioxoazocan-4-yl)amino]-2-oxo-1-thiophen-3-ylethyl]carbamate |
| SMILES | O=C(NC(C(=O)NC1CCCCNC(=O)C1=O)c1ccsc1)OCc1ccccc1 |
| InChI | InChI=1S/C21H23N3O5S/c25-18-16(8-4-5-10-22-20(18)27)23-19(26)17(15-9-11-30-13-15)24-21(28)29-12-14-6-2-1-3-7-14/h1-3,6-7,9,11,13,16-17H,4-5,8,10,12H2,(H,22,27)(H,23,26)(H,24,28) |
| InChIKey | JKPCZNATKLVRKK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|