C20H22N4O5S — CID 138730930
benzyl N-[2-[(2,3-dioxoazocan-4-yl)amino]-2-oxo-1-(1,3-thiazol-5-yl)ethyl]carbamate (PubChem CID 138730930) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is benzyl N-[2-[(2,3-dioxoazocan-4-yl)amino]-2-oxo-1-(1,3-thiazol-5-yl)ethyl]carbamate.
| Compound Name | benzyl N-[2-[(2,3-dioxoazocan-4-yl)amino]-2-oxo-1-(1,3-thiazol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 138730930 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | benzyl N-[2-[(2,3-dioxoazocan-4-yl)amino]-2-oxo-1-(1,3-thiazol-5-yl)ethyl]carbamate |
| SMILES | O=C(NC(C(=O)NC1CCCCNC(=O)C1=O)c1cncs1)OCc1ccccc1 |
| InChI | InChI=1S/C20H22N4O5S/c25-17-14(8-4-5-9-22-19(17)27)23-18(26)16(15-10-21-12-30-15)24-20(28)29-11-13-6-2-1-3-7-13/h1-3,6-7,10,12,14,16H,4-5,8-9,11H2,(H,22,27)(H,23,26)(H,24,28) |
| InChIKey | YFJOUCPGLGKDHW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|