C20H21N3O6 — CID 160610848
benzyl N-[3-(2,3-dioxoazepan-4-yl)-1-(1,3-oxazol-5-yl)-2-oxopropyl]carbamate (PubChem CID 160610848) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is benzyl N-[3-(2,3-dioxoazepan-4-yl)-1-(1,3-oxazol-5-yl)-2-oxopropyl]carbamate.
| Compound Name | benzyl N-[3-(2,3-dioxoazepan-4-yl)-1-(1,3-oxazol-5-yl)-2-oxopropyl]carbamate |
|---|---|
| PubChem CID | 160610848 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | benzyl N-[3-(2,3-dioxoazepan-4-yl)-1-(1,3-oxazol-5-yl)-2-oxopropyl]carbamate |
| SMILES | O=C(NC(C(=O)CC1CCCNC(=O)C1=O)c1cnco1)OCc1ccccc1 |
| InChI | InChI=1S/C20H21N3O6/c24-15(9-14-7-4-8-22-19(26)18(14)25)17(16-10-21-12-29-16)23-20(27)28-11-13-5-2-1-3-6-13/h1-3,5-6,10,12,14,17H,4,7-9,11H2,(H,22,26)(H,23,27) |
| InChIKey | RFMKQZDBSHYRJI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|