C24H30N4O5 — CID 160647655
benzyl N-[1-(7,8-dioxo-5,6,9,10,11,12-hexahydroimidazo[1,5-a][1,6]diazecin-6-yl)-4-methyl-2-oxopentan-3-yl]carbamate (PubChem CID 160647655) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is benzyl N-[1-(7,8-dioxo-5,6,9,10,11,12-hexahydroimidazo[1,5-a][1,6]diazecin-6-yl)-4-methyl-2-oxopentan-3-yl]carbamate.
| Compound Name | benzyl N-[1-(7,8-dioxo-5,6,9,10,11,12-hexahydroimidazo[1,5-a][1,6]diazecin-6-yl)-4-methyl-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 160647655 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | benzyl N-[1-(7,8-dioxo-5,6,9,10,11,12-hexahydroimidazo[1,5-a][1,6]diazecin-6-yl)-4-methyl-2-oxopentan-3-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)CC1Cn2cncc2CCCNC(=O)C1=O |
| InChI | InChI=1S/C24H30N4O5/c1-16(2)21(27-24(32)33-14-17-7-4-3-5-8-17)20(29)11-18-13-28-15-25-12-19(28)9-6-10-26-23(31)22(18)30/h3-5,7-8,12,15-16,18,21H,6,9-11,13-14H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | RJZPPTDCODEGRA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|