C21H28N2O5 — CID 159420540
benzyl N-[1-(2,3-dioxoazocan-4-yl)-4-methyl-2-oxopentan-3-yl]carbamate (PubChem CID 159420540) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is benzyl N-[1-(2,3-dioxoazocan-4-yl)-4-methyl-2-oxopentan-3-yl]carbamate.
| Compound Name | benzyl N-[1-(2,3-dioxoazocan-4-yl)-4-methyl-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 159420540 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | benzyl N-[1-(2,3-dioxoazocan-4-yl)-4-methyl-2-oxopentan-3-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)CC1CCCCNC(=O)C1=O |
| InChI | InChI=1S/C21H28N2O5/c1-14(2)18(23-21(27)28-13-15-8-4-3-5-9-15)17(24)12-16-10-6-7-11-22-20(26)19(16)25/h3-5,8-9,14,16,18H,6-7,10-13H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | LPSDPKYEGJXFGQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|