C24H29N3O5S — CID 149329394
benzyl N-[1-(7,8-dioxo-4,5,6,9,10,11-hexahydro-[1,3]thiazolo[4,5-d]azecin-9-yl)-4-methyl-2-oxopentan-3-yl]carbamate (PubChem CID 149329394) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is benzyl N-[1-(7,8-dioxo-4,5,6,9,10,11-hexahydro-[1,3]thiazolo[4,5-d]azecin-9-yl)-4-methyl-2-oxopentan-3-yl]carbamate.
| Compound Name | benzyl N-[1-(7,8-dioxo-4,5,6,9,10,11-hexahydro-[1,3]thiazolo[4,5-d]azecin-9-yl)-4-methyl-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 149329394 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | benzyl N-[1-(7,8-dioxo-4,5,6,9,10,11-hexahydro-[1,3]thiazolo[4,5-d]azecin-9-yl)-4-methyl-2-oxopentan-3-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)CC1CCc2scnc2CCNC(=O)C1=O |
| InChI | InChI=1S/C24H29N3O5S/c1-15(2)21(27-24(31)32-13-16-6-4-3-5-7-16)19(28)12-17-8-9-20-18(26-14-33-20)10-11-25-23(30)22(17)29/h3-7,14-15,17,21H,8-13H2,1-2H3,(H,25,30)(H,27,31) |
| InChIKey | YCACGBIJDQOPOZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|