C26H31N3O5 — CID 159033028
benzyl N-[1-(7,8-dioxo-5,6,9,10,11,12-hexahydropyrido[3,4-e]azecin-6-yl)-4-methyl-2-oxopentan-3-yl]carbamate (PubChem CID 159033028) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is benzyl N-[1-(7,8-dioxo-5,6,9,10,11,12-hexahydropyrido[3,4-e]azecin-6-yl)-4-methyl-2-oxopentan-3-yl]carbamate.
| Compound Name | benzyl N-[1-(7,8-dioxo-5,6,9,10,11,12-hexahydropyrido[3,4-e]azecin-6-yl)-4-methyl-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 159033028 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | benzyl N-[1-(7,8-dioxo-5,6,9,10,11,12-hexahydropyrido[3,4-e]azecin-6-yl)-4-methyl-2-oxopentan-3-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)CC1Cc2ccncc2CCCNC(=O)C1=O |
| InChI | InChI=1S/C26H31N3O5/c1-17(2)23(29-26(33)34-16-18-7-4-3-5-8-18)22(30)14-21-13-19-10-12-27-15-20(19)9-6-11-28-25(32)24(21)31/h3-5,7-8,10,12,15,17,21,23H,6,9,11,13-14,16H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | JVCRLHBGDRZFGT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|