C28H36N4O7 — CID 148828974
benzyl 3-[[1-(7,8-dioxo-5,6,9,10-tetrahydro-4H-oxadiazolo[5,4-d]azonin-9-yl)-4-methyl-2-oxopentan-3-yl]carbamoyl]-4-methylpentanoate (PubChem CID 148828974) has the molecular formula C28H36N4O7 and a molecular weight of 540.62 g/mol. Its IUPAC name is benzyl 3-[[1-(7,8-dioxo-5,6,9,10-tetrahydro-4H-oxadiazolo[5,4-d]azonin-9-yl)-4-methyl-2-oxopentan-3-yl]carbamoyl]-4-methylpentanoate.
| Compound Name | benzyl 3-[[1-(7,8-dioxo-5,6,9,10-tetrahydro-4H-oxadiazolo[5,4-d]azonin-9-yl)-4-methyl-2-oxopentan-3-yl]carbamoyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 148828974 |
| Molecular Formula | C28H36N4O7 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | benzyl 3-[[1-(7,8-dioxo-5,6,9,10-tetrahydro-4H-oxadiazolo[5,4-d]azonin-9-yl)-4-methyl-2-oxopentan-3-yl]carbamoyl]-4-methylpentanoate |
| SMILES | CC(C)C(CC(=O)OCc1ccccc1)C(=O)NC(C(=O)CC1Cc2nnoc2CCNC(=O)C1=O)C(C)C |
| InChI | InChI=1S/C28H36N4O7/c1-16(2)20(14-24(34)38-15-18-8-6-5-7-9-18)27(36)30-25(17(3)4)22(33)13-19-12-21-23(39-32-31-21)10-11-29-28(37)26(19)35/h5-9,16-17,19-20,25H,10-15H2,1-4H3,(H,29,37)(H,30,36) |
| InChIKey | OTHIUGVBSMNONM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 157.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|