C19H25N3O5 — CID 130420335
benzyl N-[(2S)-1-[(2,3-dioxoazepan-4-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 130420335) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(2,3-dioxoazepan-4-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(2,3-dioxoazepan-4-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 130420335 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | benzyl N-[(2S)-1-[(2,3-dioxoazepan-4-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)NC1CCCNC(=O)C1=O |
| InChI | InChI=1S/C19H25N3O5/c1-12(2)15(22-19(26)27-11-13-7-4-3-5-8-13)17(24)21-14-9-6-10-20-18(25)16(14)23/h3-5,7-8,12,14-15H,6,9-11H2,1-2H3,(H,20,25)(H,21,24)(H,22,26)/t14?,15-/m0/s1 |
| InChIKey | UJWXBMZGSGQRKK-LOACHALJSA-N |
| XLogP | 0.90 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|