C21H29N3O5 — CID 138731446
benzyl N-[1-[(2,3-dioxoazocan-4-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 138731446) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is benzyl N-[1-[(2,3-dioxoazocan-4-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(2,3-dioxoazocan-4-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 138731446 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | benzyl N-[1-[(2,3-dioxoazocan-4-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)NC1CCCCNC(=O)C1=O |
| InChI | InChI=1S/C21H29N3O5/c1-14(2)12-17(24-21(28)29-13-15-8-4-3-5-9-15)19(26)23-16-10-6-7-11-22-20(27)18(16)25/h3-5,8-9,14,16-17H,6-7,10-13H2,1-2H3,(H,22,27)(H,23,26)(H,24,28) |
| InChIKey | GADJNEQIYNZNBJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|