C27H35N5O5 — CID 138731256
benzyl N-[1-[(7,8-dioxo-6,14,15-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-9-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 138731256) has the molecular formula C27H35N5O5 and a molecular weight of 509.61 g/mol. Its IUPAC name is benzyl N-[1-[(7,8-dioxo-6,14,15-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-9-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(7,8-dioxo-6,14,15-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-9-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 138731256 |
| Molecular Formula | C27H35N5O5 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | benzyl N-[1-[(7,8-dioxo-6,14,15-triazabicyclo[10.4.0]hexadeca-1(16),12,14-trien-9-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)NC1CCc2cnncc2CCCCNC(=O)C1=O |
| InChI | InChI=1S/C27H35N5O5/c1-18(2)14-23(32-27(36)37-17-19-8-4-3-5-9-19)25(34)31-22-12-11-21-16-30-29-15-20(21)10-6-7-13-28-26(35)24(22)33/h3-5,8-9,15-16,18,22-23H,6-7,10-14,17H2,1-2H3,(H,28,35)(H,31,34)(H,32,36) |
| InChIKey | SHPNFTHXFCBDMK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|